![[1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine (CAS: 959240-31-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0739822.png "[1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine chemical structure")
[1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine
Catalog No: FT-0739822
CAS No: 959240-31-4
- Chemical Name: [1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine
- Molecular Formula: C11H23N3
- Molecular Weight: 197.32
- InChI Key: KUTJXIZFVLYHEV-UHFFFAOYSA-N
- InChI: InChI=1S/C11H23N3/c1-13-6-8-14(9-7-13)11(10-12)4-2-3-5-11/h2-10,12H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 250.7ºC at 760 mmHg |
|---|---|
| CAS: | 959240-31-4 |
| MF: | C11H23N3 |
| Density: | 1.016g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | [1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine |
| Flash_Point: | 104.3ºC |
| FW: | 197.32000 |
| Density: | 1.016g/cm3 |
|---|---|
| MF: | C11H23N3 |
| LogP: | 1.08140 |
| Exact_Mass: | 197.18900 |
| Bolling_Point: | 250.7ºC at 760 mmHg |
| Flash_Point: | 104.3ºC |
| FW: | 197.32000 |
| Refractive_Index: | 1.525 |
| PSA: | 32.50000 |
| HS_Code: | 2933599090 |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-